C16H21N3O2S2 — CID 113030864
5-methyl-N-[5-(3-methylpiperidin-1-yl)-2-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113030864) has the molecular formula C16H21N3O2S2 and a molecular weight of 351.50 g/mol. Its IUPAC name is 5-methyl-N-[5-(3-methylpiperidin-1-yl)-2-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[5-(3-methylpiperidin-1-yl)-2-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113030864 |
| Molecular Formula | C16H21N3O2S2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 5-methyl-N-[5-(3-methylpiperidin-1-yl)-2-pyridinyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N3CCCC(C)C3)cn2)s1 |
| InChI | InChI=1S/C16H21N3O2S2/c1-12-4-3-9-19(11-12)14-6-7-15(17-10-14)18-23(20,21)16-8-5-13(2)22-16/h5-8,10,12H,3-4,9,11H2,1-2H3,(H,17,18) |
| InChIKey | JQOSXDCDCDRZRB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |