C23H18Cl2N4O2S2 — CID 134227739
2-[[4,5-bis(4-chlorophenyl)-2-pyridinyl]methyl]-1-thiophen-2-ylsulfonylguanidine (PubChem CID 134227739) has the molecular formula C23H18Cl2N4O2S2 and a molecular weight of 517.46 g/mol. Its IUPAC name is 2-[[4,5-bis(4-chlorophenyl)-2-pyridinyl]methyl]-1-thiophen-2-ylsulfonylguanidine.
| Compound Name | 2-[[4,5-bis(4-chlorophenyl)-2-pyridinyl]methyl]-1-thiophen-2-ylsulfonylguanidine |
|---|---|
| PubChem CID | 134227739 |
| Molecular Formula | C23H18Cl2N4O2S2 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | 2-[[4,5-bis(4-chlorophenyl)-2-pyridinyl]methyl]-1-thiophen-2-ylsulfonylguanidine |
| SMILES | N/C(=N\Cc1cc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)cn1)NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C23H18Cl2N4O2S2/c24-17-7-3-15(4-8-17)20-12-19(27-14-21(20)16-5-9-18(25)10-6-16)13-28-23(26)29-33(30,31)22-2-1-11-32-22/h1-12,14H,13H2,(H3,26,28,29) |
| InChIKey | XQTZCBPRDMDVFC-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|