C12H13ClN4O3S2 — CID 133397446
5-chloro-6-[2-(thiophen-2-ylsulfonylamino)ethylamino]pyridine-3-carboxamide (PubChem CID 133397446) has the molecular formula C12H13ClN4O3S2 and a molecular weight of 360.85 g/mol. Its IUPAC name is 5-chloro-6-[2-(thiophen-2-ylsulfonylamino)ethylamino]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[2-(thiophen-2-ylsulfonylamino)ethylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133397446 |
| Molecular Formula | C12H13ClN4O3S2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 5-chloro-6-[2-(thiophen-2-ylsulfonylamino)ethylamino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(NCCNS(=O)(=O)c2cccs2)c(Cl)c1 |
| InChI | InChI=1S/C12H13ClN4O3S2/c13-9-6-8(11(14)18)7-16-12(9)15-3-4-17-22(19,20)10-2-1-5-21-10/h1-2,5-7,17H,3-4H2,(H2,14,18)(H,15,16) |
| InChIKey | DYPOADLDMIESLH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|