C13H11BrClN3O — CID 133292879
6-[(4-bromophenyl)methylamino]-5-chloropyridine-3-carboxamide (PubChem CID 133292879) has the molecular formula C13H11BrClN3O and a molecular weight of 340.61 g/mol. Its IUPAC name is 6-[(4-bromophenyl)methylamino]-5-chloropyridine-3-carboxamide.
| Compound Name | 6-[(4-bromophenyl)methylamino]-5-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 133292879 |
| Molecular Formula | C13H11BrClN3O |
| Molecular Weight | 340.61 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 6-[(4-bromophenyl)methylamino]-5-chloropyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(NCc2ccc(Br)cc2)c(Cl)c1 |
| InChI | InChI=1S/C13H11BrClN3O/c14-10-3-1-8(2-4-10)6-17-13-11(15)5-9(7-18-13)12(16)19/h1-5,7H,6H2,(H2,16,19)(H,17,18) |
| InChIKey | VZUXTQUHPVLRMI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.61 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |