C18H20BrClN4O — CID 133366936
6-[[1-[(4-bromophenyl)methyl]piperidin-4-yl]amino]-5-chloropyridine-3-carboxamide (PubChem CID 133366936) has the molecular formula C18H20BrClN4O and a molecular weight of 423.74 g/mol. Its IUPAC name is 6-[[1-[(4-bromophenyl)methyl]piperidin-4-yl]amino]-5-chloropyridine-3-carboxamide.
| Compound Name | 6-[[1-[(4-bromophenyl)methyl]piperidin-4-yl]amino]-5-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 133366936 |
| Molecular Formula | C18H20BrClN4O |
| Molecular Weight | 423.74 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 6-[[1-[(4-bromophenyl)methyl]piperidin-4-yl]amino]-5-chloropyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(NC2CCN(Cc3ccc(Br)cc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C18H20BrClN4O/c19-14-3-1-12(2-4-14)11-24-7-5-15(6-8-24)23-18-16(20)9-13(10-22-18)17(21)25/h1-4,9-10,15H,5-8,11H2,(H2,21,25)(H,22,23) |
| InChIKey | AVNFJEIUOXKHOE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.74 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |