C19H23ClN4 — CID 141133485
3-chloro-5-prop-2-enyl-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]pyridin-2-amine (PubChem CID 141133485) has the molecular formula C19H23ClN4 and a molecular weight of 342.87 g/mol. Its IUPAC name is 3-chloro-5-prop-2-enyl-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]pyridin-2-amine.
| Compound Name | 3-chloro-5-prop-2-enyl-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 141133485 |
| Molecular Formula | C19H23ClN4 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-chloro-5-prop-2-enyl-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]pyridin-2-amine |
| SMILES | C=CCc1cnc(NC2CCN(Cc3ccncc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C19H23ClN4/c1-2-3-16-12-18(20)19(22-13-16)23-17-6-10-24(11-7-17)14-15-4-8-21-9-5-15/h2,4-5,8-9,12-13,17H,1,3,6-7,10-11,14H2,(H,22,23) |
| InChIKey | QVAODRQFDUAVJF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|