C18H24ClN5 — CID 113258960
4-N-(1-benzylpiperidin-4-yl)-5-chloro-2-N-ethylpyrimidine-2,4-diamine (PubChem CID 113258960) has the molecular formula C18H24ClN5 and a molecular weight of 345.88 g/mol. Its IUPAC name is 4-N-(1-benzylpiperidin-4-yl)-5-chloro-2-N-ethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(1-benzylpiperidin-4-yl)-5-chloro-2-N-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 113258960 |
| Molecular Formula | C18H24ClN5 |
| Molecular Weight | 345.88 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 4-N-(1-benzylpiperidin-4-yl)-5-chloro-2-N-ethylpyrimidine-2,4-diamine |
| SMILES | CCNc1ncc(Cl)c(NC2CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C18H24ClN5/c1-2-20-18-21-12-16(19)17(23-18)22-15-8-10-24(11-9-15)13-14-6-4-3-5-7-14/h3-7,12,15H,2,8-11,13H2,1H3,(H2,20,21,22,23) |
| InChIKey | BYSGIJQEKVMISQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.88 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |