C18H21ClN4O2 — CID 136552683
5-chloro-6-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]methylamino]pyridine-3-carboxylic acid (PubChem CID 136552683) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is 5-chloro-6-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]methylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-6-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]methylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 136552683 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 5-chloro-6-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]methylamino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCC2CCN(Cc3ccncc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C18H21ClN4O2/c19-16-9-15(18(24)25)11-22-17(16)21-10-13-3-7-23(8-4-13)12-14-1-5-20-6-2-14/h1-2,5-6,9,11,13H,3-4,7-8,10,12H2,(H,21,22)(H,24,25) |
| InChIKey | XLHIPIJHOZIUMW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |