C12H16ClN3O3 — CID 79071332
5-chloro-6-[(4-methylmorpholin-2-yl)methylamino]pyridine-3-carboxylic acid (PubChem CID 79071332) has the molecular formula C12H16ClN3O3 and a molecular weight of 285.73 g/mol. Its IUPAC name is 5-chloro-6-[(4-methylmorpholin-2-yl)methylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-6-[(4-methylmorpholin-2-yl)methylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 79071332 |
| Molecular Formula | C12H16ClN3O3 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 5-chloro-6-[(4-methylmorpholin-2-yl)methylamino]pyridine-3-carboxylic acid |
| SMILES | CN1CCOC(CNc2ncc(C(=O)O)cc2Cl)C1 |
| InChI | InChI=1S/C12H16ClN3O3/c1-16-2-3-19-9(7-16)6-15-11-10(13)4-8(5-14-11)12(17)18/h4-5,9H,2-3,6-7H2,1H3,(H,14,15)(H,17,18) |
| InChIKey | YSSWLJRSIZBJBC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |