C21H27Cl3N4O3 — CID 87636956
(E)-3-[5-chloro-6-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;dihydrochloride (PubChem CID 87636956) has the molecular formula C21H27Cl3N4O3 and a molecular weight of 489.83 g/mol. Its IUPAC name is (E)-3-[5-chloro-6-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;dihydrochloride.
| Compound Name | (E)-3-[5-chloro-6-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;dihydrochloride |
|---|---|
| PubChem CID | 87636956 |
| Molecular Formula | C21H27Cl3N4O3 |
| Molecular Weight | 489.83 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | (E)-3-[5-chloro-6-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide;dihydrochloride |
| SMILES | COc1ccc(CN2CCC(Nc3ncc(/C=C/C(=O)NO)cc3Cl)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C21H25ClN4O3.2ClH/c1-29-18-5-2-15(3-6-18)14-26-10-8-17(9-11-26)24-21-19(22)12-16(13-23-21)4-7-20(27)25-28;;/h2-7,12-13,17,28H,8-11,14H2,1H3,(H,23,24)(H,25,27);2*1H/b7-4+;; |
| InChIKey | MLEZZPRJMZGLMD-RDRKJGRWSA-N |
| XLogP | 4.18 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.83 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|