C20H21ClN4O3 — CID 90967564
3-[6-[(1-benzoylpiperidin-4-yl)amino]-5-chloro-3-pyridinyl]-N-hydroxyprop-2-enamide (PubChem CID 90967564) has the molecular formula C20H21ClN4O3 and a molecular weight of 400.87 g/mol. Its IUPAC name is 3-[6-[(1-benzoylpiperidin-4-yl)amino]-5-chloro-3-pyridinyl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[6-[(1-benzoylpiperidin-4-yl)amino]-5-chloro-3-pyridinyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 90967564 |
| Molecular Formula | C20H21ClN4O3 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 3-[6-[(1-benzoylpiperidin-4-yl)amino]-5-chloro-3-pyridinyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(C=Cc1cnc(NC2CCN(C(=O)c3ccccc3)CC2)c(Cl)c1)NO |
| InChI | InChI=1S/C20H21ClN4O3/c21-17-12-14(6-7-18(26)24-28)13-22-19(17)23-16-8-10-25(11-9-16)20(27)15-4-2-1-3-5-15/h1-7,12-13,16,28H,8-11H2,(H,22,23)(H,24,26) |
| InChIKey | JDLOWSYKLRYATB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|