C19H18Cl2N4O3 — CID 90712877
3-[5-chloro-6-[[(3R)-1-(2-chlorobenzoyl)pyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide (PubChem CID 90712877) has the molecular formula C19H18Cl2N4O3 and a molecular weight of 421.28 g/mol. Its IUPAC name is 3-[5-chloro-6-[[(3R)-1-(2-chlorobenzoyl)pyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[5-chloro-6-[[(3R)-1-(2-chlorobenzoyl)pyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 90712877 |
| Molecular Formula | C19H18Cl2N4O3 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 3-[5-chloro-6-[[(3R)-1-(2-chlorobenzoyl)pyrrolidin-3-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(C=Cc1cnc(N[C@@H]2CCN(C(=O)c3ccccc3Cl)C2)c(Cl)c1)NO |
| InChI | InChI=1S/C19H18Cl2N4O3/c20-15-4-2-1-3-14(15)19(27)25-8-7-13(11-25)23-18-16(21)9-12(10-22-18)5-6-17(26)24-28/h1-6,9-10,13,28H,7-8,11H2,(H,22,23)(H,24,26)/t13-/m1/s1 |
| InChIKey | CECYKEGGBGMYML-CYBMUJFWSA-N |
| XLogP | 3.23 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|