C17H25ClN4O2 — CID 87637881
(E)-3-[5-chloro-6-[[1-(2-methylpropyl)piperidin-4-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide (PubChem CID 87637881) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is (E)-3-[5-chloro-6-[[1-(2-methylpropyl)piperidin-4-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[5-chloro-6-[[1-(2-methylpropyl)piperidin-4-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 87637881 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (E)-3-[5-chloro-6-[[1-(2-methylpropyl)piperidin-4-yl]amino]-3-pyridinyl]-N-hydroxyprop-2-enamide |
| SMILES | CC(C)CN1CCC(Nc2ncc(/C=C/C(=O)NO)cc2Cl)CC1 |
| InChI | InChI=1S/C17H25ClN4O2/c1-12(2)11-22-7-5-14(6-8-22)20-17-15(18)9-13(10-19-17)3-4-16(23)21-24/h3-4,9-10,12,14,24H,5-8,11H2,1-2H3,(H,19,20)(H,21,23)/b4-3+ |
| InChIKey | YACDMUWJBSZKSM-ONEGZZNKSA-N |
| XLogP | 2.79 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|