C10H12ClN3O3 — CID 122058630
4-[(5-carbamoyl-3-chloro-2-pyridinyl)amino]butanoic acid (PubChem CID 122058630) has the molecular formula C10H12ClN3O3 and a molecular weight of 257.68 g/mol. Its IUPAC name is 4-[(5-carbamoyl-3-chloro-2-pyridinyl)amino]butanoic acid.
| Compound Name | 4-[(5-carbamoyl-3-chloro-2-pyridinyl)amino]butanoic acid |
|---|---|
| PubChem CID | 122058630 |
| Molecular Formula | C10H12ClN3O3 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 4-[(5-carbamoyl-3-chloro-2-pyridinyl)amino]butanoic acid |
| SMILES | NC(=O)c1cnc(NCCCC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C10H12ClN3O3/c11-7-4-6(9(12)17)5-14-10(7)13-3-1-2-8(15)16/h4-5H,1-3H2,(H2,12,17)(H,13,14)(H,15,16) |
| InChIKey | KJEXNAFUUDADGF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|