C12H11BrClN3 — CID 103582888
N-[(4-aminophenyl)methyl]-5-bromo-3-chloropyridin-2-amine (PubChem CID 103582888) has the molecular formula C12H11BrClN3 and a molecular weight of 312.60 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-5-bromo-3-chloropyridin-2-amine.
| Compound Name | N-[(4-aminophenyl)methyl]-5-bromo-3-chloropyridin-2-amine |
|---|---|
| PubChem CID | 103582888 |
| Molecular Formula | C12H11BrClN3 |
| Molecular Weight | 312.60 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-5-bromo-3-chloropyridin-2-amine |
| SMILES | Nc1ccc(CNc2ncc(Br)cc2Cl)cc1 |
| InChI | InChI=1S/C12H11BrClN3/c13-9-5-11(14)12(17-7-9)16-6-8-1-3-10(15)4-2-8/h1-5,7H,6,15H2,(H,16,17) |
| InChIKey | TXHVLCNZOHMOIU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|