C12H15FN4O2S2 — CID 133421743
N-[2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide (PubChem CID 133421743) has the molecular formula C12H15FN4O2S2 and a molecular weight of 330.41 g/mol. Its IUPAC name is N-[2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 133421743 |
| Molecular Formula | C12H15FN4O2S2 |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | N-[2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
| SMILES | CCc1ncnc(NCCNS(=O)(=O)c2cccs2)c1F |
| InChI | InChI=1S/C12H15FN4O2S2/c1-2-9-11(13)12(16-8-15-9)14-5-6-17-21(18,19)10-4-3-7-20-10/h3-4,7-8,17H,2,5-6H2,1H3,(H,14,15,16) |
| InChIKey | SQQCFWWKDFQMLR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|