C13H16FN5O2S — CID 133421659
N-[2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]ethyl]pyridine-3-sulfonamide (PubChem CID 133421659) has the molecular formula C13H16FN5O2S and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]ethyl]pyridine-3-sulfonamide.
| Compound Name | N-[2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133421659 |
| Molecular Formula | C13H16FN5O2S |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-[2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]ethyl]pyridine-3-sulfonamide |
| SMILES | CCc1ncnc(NCCNS(=O)(=O)c2cccnc2)c1F |
| InChI | InChI=1S/C13H16FN5O2S/c1-2-11-12(14)13(18-9-17-11)16-6-7-19-22(20,21)10-4-3-5-15-8-10/h3-5,8-9,19H,2,6-7H2,1H3,(H,16,17,18) |
| InChIKey | UBEONUGRIJWNEU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|