C15H17N5O2S2 — CID 133423697
N-[2-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]pyridine-3-sulfonamide (PubChem CID 133423697) has the molecular formula C15H17N5O2S2 and a molecular weight of 363.47 g/mol. Its IUPAC name is N-[2-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]pyridine-3-sulfonamide.
| Compound Name | N-[2-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133423697 |
| Molecular Formula | C15H17N5O2S2 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | N-[2-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]pyridine-3-sulfonamide |
| SMILES | CCc1nc(NCCNS(=O)(=O)c2cccnc2)c2ccsc2n1 |
| InChI | InChI=1S/C15H17N5O2S2/c1-2-13-19-14(12-5-9-23-15(12)20-13)17-7-8-18-24(21,22)11-4-3-6-16-10-11/h3-6,9-10,18H,2,7-8H2,1H3,(H,17,19,20) |
| InChIKey | BBZYBQRZHQRDBI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|