4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid

C12H15N3O2S — CID 122058535

IUPAC4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid
SMILESCCc1nc(NCCCC(=O)O)c2ccsc2n1
InChIInChI=1S/C12H15N3O2S/c1-2-9-14-11(13-6-3-4-10(16)17)8-5-7-18-12(8)15-9/h5,7H,2-4,6H2,1H3,(H,16,17)(H,13,14,15)
InChIKeyDLBPRWDPIAOEDI-UHFFFAOYSA-N
MW265.34 g/mol
LogP2.53
Rot. Bonds6

About 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid

4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid (PubChem CID 122058535) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid.

Molecular Properties

Compound Name4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid
PubChem CID122058535
Molecular FormulaC12H15N3O2S
Molecular Weight265.34 g/mol
Exact Mass265.09
IUPAC Name4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid
SMILESCCc1nc(NCCCC(=O)O)c2ccsc2n1
InChIInChI=1S/C12H15N3O2S/c1-2-9-14-11(13-6-3-4-10(16)17)8-5-7-18-12(8)15-9/h5,7H,2-4,6H2,1H3,(H,16,17)(H,13,14,15)
InChIKeyDLBPRWDPIAOEDI-UHFFFAOYSA-N
XLogP2.53
TPSA75.11 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.34
LogP ≤ 52.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid?
The IUPAC name of 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid (CID 122058535) is 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid.
What is the SMILES notation for 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid?
The canonical SMILES for 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid is CCc1nc(NCCCC(=O)O)c2ccsc2n1.
What is the InChIKey of 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid?
The InChIKey is DLBPRWDPIAOEDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2S/c1-2-9-14-11(13-6-3-4-10(16)17)8-5-7-18-12(8)15-9/h5,7H,2-4,6H2,1H3,(H,16,17)(H,13,14,15).
What are the key properties of 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid?
4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid has a molecular weight of 265.34 g/mol, XLogP of 2.53, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid is sourced from PubChem (CID 122058535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).