C14H16N4S — CID 133403949
2-ethyl-N-(2-pyrrol-1-ylethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 133403949) has the molecular formula C14H16N4S and a molecular weight of 272.38 g/mol. Its IUPAC name is 2-ethyl-N-(2-pyrrol-1-ylethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-ethyl-N-(2-pyrrol-1-ylethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133403949 |
| Molecular Formula | C14H16N4S |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-ethyl-N-(2-pyrrol-1-ylethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1nc(NCCn2cccc2)c2ccsc2n1 |
| InChI | InChI=1S/C14H16N4S/c1-2-12-16-13(11-5-10-19-14(11)17-12)15-6-9-18-7-3-4-8-18/h3-5,7-8,10H,2,6,9H2,1H3,(H,15,16,17) |
| InChIKey | MYZLMJVJZVXYNW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |