C15H16FN5S — CID 133418455
N'-(1,3-benzothiazol-2-yl)-N-(6-ethyl-5-fluoropyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 133418455) has the molecular formula C15H16FN5S and a molecular weight of 317.39 g/mol. Its IUPAC name is N'-(1,3-benzothiazol-2-yl)-N-(6-ethyl-5-fluoropyrimidin-4-yl)ethane-1,2-diamine.
| Compound Name | N'-(1,3-benzothiazol-2-yl)-N-(6-ethyl-5-fluoropyrimidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 133418455 |
| Molecular Formula | C15H16FN5S |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N'-(1,3-benzothiazol-2-yl)-N-(6-ethyl-5-fluoropyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | CCc1ncnc(NCCNc2nc3ccccc3s2)c1F |
| InChI | InChI=1S/C15H16FN5S/c1-2-10-13(16)14(20-9-19-10)17-7-8-18-15-21-11-5-3-4-6-12(11)22-15/h3-6,9H,2,7-8H2,1H3,(H,18,21)(H,17,19,20) |
| InChIKey | FWNXDJFDMLNOJR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|