C14H15N5S — CID 47370704
N'-(1,3-benzothiazol-2-yl)-N-pyrimidin-2-ylpropane-1,3-diamine (PubChem CID 47370704) has the molecular formula C14H15N5S and a molecular weight of 285.38 g/mol. Its IUPAC name is N'-(1,3-benzothiazol-2-yl)-N-pyrimidin-2-ylpropane-1,3-diamine.
| Compound Name | N'-(1,3-benzothiazol-2-yl)-N-pyrimidin-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 47370704 |
| Molecular Formula | C14H15N5S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N'-(1,3-benzothiazol-2-yl)-N-pyrimidin-2-ylpropane-1,3-diamine |
| SMILES | c1cnc(NCCCNc2nc3ccccc3s2)nc1 |
| InChI | InChI=1S/C14H15N5S/c1-2-6-12-11(5-1)19-14(20-12)18-10-4-9-17-13-15-7-3-8-16-13/h1-3,5-8H,4,9-10H2,(H,18,19)(H,15,16,17) |
| InChIKey | VHCSDLJMGPMFJZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|