C15H21N5O2S2 — CID 133397420
N-[2-[(6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide (PubChem CID 133397420) has the molecular formula C15H21N5O2S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is N-[2-[(6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[(6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 133397420 |
| Molecular Formula | C15H21N5O2S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[2-[(6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCNc1cc(N2CCCCC2)ncn1)c1cccs1 |
| InChI | InChI=1S/C15H21N5O2S2/c21-24(22,15-5-4-10-23-15)19-7-6-16-13-11-14(18-12-17-13)20-8-2-1-3-9-20/h4-5,10-12,19H,1-3,6-9H2,(H,16,17,18) |
| InChIKey | AGCRHKSKIGGXHE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|