C13H9ClN2O3S2 — CID 112503125
N-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]thiophene-2-sulfonamide (PubChem CID 112503125) has the molecular formula C13H9ClN2O3S2 and a molecular weight of 340.81 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 112503125 |
| Molecular Formula | C13H9ClN2O3S2 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | N-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2ccc(Cl)cc2)no1)c1cccs1 |
| InChI | InChI=1S/C13H9ClN2O3S2/c14-10-5-3-9(4-6-10)11-8-12(19-15-11)16-21(17,18)13-2-1-7-20-13/h1-8,16H |
| InChIKey | VVNJEDJSKGTPHY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |