C11H9ClN2O2 — CID 112503051
N-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]acetamide (PubChem CID 112503051) has the molecular formula C11H9ClN2O2 and a molecular weight of 236.66 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]acetamide.
| Compound Name | N-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]acetamide |
|---|---|
| PubChem CID | 112503051 |
| Molecular Formula | C11H9ClN2O2 |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | N-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C11H9ClN2O2/c1-7(15)13-11-6-10(14-16-11)8-2-4-9(12)5-3-8/h2-6H,1H3,(H,13,15) |
| InChIKey | HAJBIPVLGJRPGZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |