C12H10ClNO3 — CID 131857629
methyl 2-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]acetate (PubChem CID 131857629) has the molecular formula C12H10ClNO3 and a molecular weight of 251.67 g/mol. Its IUPAC name is methyl 2-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]acetate.
| Compound Name | methyl 2-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]acetate |
|---|---|
| PubChem CID | 131857629 |
| Molecular Formula | C12H10ClNO3 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | methyl 2-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]acetate |
| SMILES | COC(=O)Cc1cc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C12H10ClNO3/c1-16-12(15)7-10-6-11(14-17-10)8-2-4-9(13)5-3-8/h2-6H,7H2,1H3 |
| InChIKey | UJAXCISPNSSMAR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |