C17H14ClNO2 — CID 118321395
3-(4-chlorophenyl)-5-[(4-methylphenoxy)methyl]-1,2-oxazole (PubChem CID 118321395) has the molecular formula C17H14ClNO2 and a molecular weight of 299.76 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-[(4-methylphenoxy)methyl]-1,2-oxazole.
| Compound Name | 3-(4-chlorophenyl)-5-[(4-methylphenoxy)methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 118321395 |
| Molecular Formula | C17H14ClNO2 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 3-(4-chlorophenyl)-5-[(4-methylphenoxy)methyl]-1,2-oxazole |
| SMILES | Cc1ccc(OCc2cc(-c3ccc(Cl)cc3)no2)cc1 |
| InChI | InChI=1S/C17H14ClNO2/c1-12-2-8-15(9-3-12)20-11-16-10-17(19-21-16)13-4-6-14(18)7-5-13/h2-10H,11H2,1H3 |
| InChIKey | IFCCTXBFXFQWDO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |