C17H20ClN3O4 — CID 67396874
[2-(methylamino)-2-oxoethyl] N-[4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]butyl]carbamate (PubChem CID 67396874) has the molecular formula C17H20ClN3O4 and a molecular weight of 365.82 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] N-[4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]butyl]carbamate.
| Compound Name | [2-(methylamino)-2-oxoethyl] N-[4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]butyl]carbamate |
|---|---|
| PubChem CID | 67396874 |
| Molecular Formula | C17H20ClN3O4 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] N-[4-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]butyl]carbamate |
| SMILES | CNC(=O)COC(=O)NCCCCc1cc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C17H20ClN3O4/c1-19-16(22)11-24-17(23)20-9-3-2-4-14-10-15(21-25-14)12-5-7-13(18)8-6-12/h5-8,10H,2-4,9,11H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | TZSFPIZZDIFMGK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|