C23H24ClNO5 — CID 11502868
2-[4-[3-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]propoxy]phenoxy]-2-methylbutanoic acid (PubChem CID 11502868) has the molecular formula C23H24ClNO5 and a molecular weight of 429.90 g/mol. Its IUPAC name is 2-[4-[3-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]propoxy]phenoxy]-2-methylbutanoic acid.
| Compound Name | 2-[4-[3-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]propoxy]phenoxy]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 11502868 |
| Molecular Formula | C23H24ClNO5 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 2-[4-[3-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]propoxy]phenoxy]-2-methylbutanoic acid |
| SMILES | CCC(C)(Oc1ccc(OCCCc2cc(-c3ccc(Cl)cc3)no2)cc1)C(=O)O |
| InChI | InChI=1S/C23H24ClNO5/c1-3-23(2,22(26)27)29-19-12-10-18(11-13-19)28-14-4-5-20-15-21(25-30-20)16-6-8-17(24)9-7-16/h6-13,15H,3-5,14H2,1-2H3,(H,26,27) |
| InChIKey | UUYFRDDBQFTPEZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|