C13H14FNO2 — CID 113374650
3-[3-(3-fluoro-4-methylphenyl)-1,2-oxazol-5-yl]propan-1-ol (PubChem CID 113374650) has the molecular formula C13H14FNO2 and a molecular weight of 235.26 g/mol. Its IUPAC name is 3-[3-(3-fluoro-4-methylphenyl)-1,2-oxazol-5-yl]propan-1-ol.
| Compound Name | 3-[3-(3-fluoro-4-methylphenyl)-1,2-oxazol-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 113374650 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-[3-(3-fluoro-4-methylphenyl)-1,2-oxazol-5-yl]propan-1-ol |
| SMILES | Cc1ccc(-c2cc(CCCO)on2)cc1F |
| InChI | InChI=1S/C13H14FNO2/c1-9-4-5-10(7-12(9)14)13-8-11(17-15-13)3-2-6-16/h4-5,7-8,16H,2-3,6H2,1H3 |
| InChIKey | OBIFEFBYVHLJPO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |