C11H19NO2 — CID 19894069
7-(3-methyl-1,2-oxazol-5-yl)heptan-1-ol (PubChem CID 19894069) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 7-(3-methyl-1,2-oxazol-5-yl)heptan-1-ol.
| Compound Name | 7-(3-methyl-1,2-oxazol-5-yl)heptan-1-ol |
|---|---|
| PubChem CID | 19894069 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 7-(3-methyl-1,2-oxazol-5-yl)heptan-1-ol |
| SMILES | Cc1cc(CCCCCCCO)on1 |
| InChI | InChI=1S/C11H19NO2/c1-10-9-11(14-12-10)7-5-3-2-4-6-8-13/h9,13H,2-8H2,1H3 |
| InChIKey | RBXWAAYMOMQZGU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|