C8H14N2O — CID 177319850
N-methyl-3-(3-methyl-1,2-oxazol-5-yl)propan-1-amine (PubChem CID 177319850) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is N-methyl-3-(3-methyl-1,2-oxazol-5-yl)propan-1-amine.
| Compound Name | N-methyl-3-(3-methyl-1,2-oxazol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 177319850 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | N-methyl-3-(3-methyl-1,2-oxazol-5-yl)propan-1-amine |
| SMILES | CNCCCc1cc(C)no1 |
| InChI | InChI=1S/C8H14N2O/c1-7-6-8(11-10-7)4-3-5-9-2/h6,9H,3-5H2,1-2H3 |
| InChIKey | NBLMPCMTFFPAAF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|