C11H21IN4O — CID 120973828
1,1,3,3-tetramethyl-2-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]guanidine;hydroiodide (PubChem CID 120973828) has the molecular formula C11H21IN4O and a molecular weight of 352.22 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1,1,3,3-tetramethyl-2-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120973828 |
| Molecular Formula | C11H21IN4O |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]guanidine;hydroiodide |
| SMILES | Cc1cc(CCN=C(N(C)C)N(C)C)on1.I |
| InChI | InChI=1S/C11H20N4O.HI/c1-9-8-10(16-13-9)6-7-12-11(14(2)3)15(4)5;/h8H,6-7H2,1-5H3;1H |
| InChIKey | LKTQSGCDWUZNRD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|