C17H23NO4S — CID 21271267
methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate (PubChem CID 21271267) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate.
| Compound Name | methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 21271267 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(OCCCCCCCc2cc(C)no2)cs1 |
| InChI | InChI=1S/C17H23NO4S/c1-13-10-14(22-18-13)8-6-4-3-5-7-9-21-15-11-16(23-12-15)17(19)20-2/h10-12H,3-9H2,1-2H3 |
| InChIKey | LQOXZBKAAJDINZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|