About methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate
methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate (PubChem CID 21271267) has the molecular formula C17H23NO4S
and a molecular weight of 337.44 g/mol. Its IUPAC name is methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate |
| PubChem CID | 21271267 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(OCCCCCCCc2cc(C)no2)cs1 |
| InChI | InChI=1S/C17H23NO4S/c1-13-10-14(22-18-13)8-6-4-3-5-7-9-21-15-11-16(23-12-15)17(19)20-2/h10-12H,3-9H2,1-2H3 |
| InChIKey | LQOXZBKAAJDINZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate?
The IUPAC name of methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate (CID 21271267) is methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate.
What is the SMILES notation for methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate?
The canonical SMILES for methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate is COC(=O)c1cc(OCCCCCCCc2cc(C)no2)cs1.
What is the InChIKey of methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate?
The InChIKey is LQOXZBKAAJDINZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO4S/c1-13-10-14(22-18-13)8-6-4-3-5-7-9-21-15-11-16(23-12-15)17(19)20-2/h10-12H,3-9H2,1-2H3.
What are the key properties of methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate?
methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate has a molecular weight of 337.44 g/mol, XLogP of 4.40, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxylate is sourced from PubChem (CID 21271267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).