C18H24N2O2S — CID 54231038
3-methyl-5-[5-[4-(1,3-thiazolidin-2-yl)phenoxy]pentyl]-1,2-oxazole (PubChem CID 54231038) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is 3-methyl-5-[5-[4-(1,3-thiazolidin-2-yl)phenoxy]pentyl]-1,2-oxazole.
| Compound Name | 3-methyl-5-[5-[4-(1,3-thiazolidin-2-yl)phenoxy]pentyl]-1,2-oxazole |
|---|---|
| PubChem CID | 54231038 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3-methyl-5-[5-[4-(1,3-thiazolidin-2-yl)phenoxy]pentyl]-1,2-oxazole |
| SMILES | Cc1cc(CCCCCOc2ccc(C3NCCS3)cc2)on1 |
| InChI | InChI=1S/C18H24N2O2S/c1-14-13-17(22-20-14)5-3-2-4-11-21-16-8-6-15(7-9-16)18-19-10-12-23-18/h6-9,13,18-19H,2-5,10-12H2,1H3 |
| InChIKey | QJGVWBJTGIPFLE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|