C18H26N2O4S — CID 54531037
N-(2-hydroxyethyl)-4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxamide (PubChem CID 54531037) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 54531037 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-(2-hydroxyethyl)-4-[7-(3-methyl-1,2-oxazol-5-yl)heptoxy]thiophene-2-carboxamide |
| SMILES | Cc1cc(CCCCCCCOc2csc(C(=O)NCCO)c2)on1 |
| InChI | InChI=1S/C18H26N2O4S/c1-14-11-15(24-20-14)7-5-3-2-4-6-10-23-16-12-17(25-13-16)18(22)19-8-9-21/h11-13,21H,2-10H2,1H3,(H,19,22) |
| InChIKey | YWOCPLCLKUUPHB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|