C10H15NO3S — CID 106843518
N-(4-hydroxybutyl)-4-methoxythiophene-2-carboxamide (PubChem CID 106843518) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-4-methoxythiophene-2-carboxamide.
| Compound Name | N-(4-hydroxybutyl)-4-methoxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 106843518 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | N-(4-hydroxybutyl)-4-methoxythiophene-2-carboxamide |
| SMILES | COc1csc(C(=O)NCCCCO)c1 |
| InChI | InChI=1S/C10H15NO3S/c1-14-8-6-9(15-7-8)10(13)11-4-2-3-5-12/h6-7,12H,2-5H2,1H3,(H,11,13) |
| InChIKey | LNVWTCXMDRQFGA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|