C9H14N2O2S — CID 81122879
4-methoxy-N-[2-(methylamino)ethyl]thiophene-2-carboxamide (PubChem CID 81122879) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 4-methoxy-N-[2-(methylamino)ethyl]thiophene-2-carboxamide.
| Compound Name | 4-methoxy-N-[2-(methylamino)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 81122879 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 4-methoxy-N-[2-(methylamino)ethyl]thiophene-2-carboxamide |
| SMILES | CNCCNC(=O)c1cc(OC)cs1 |
| InChI | InChI=1S/C9H14N2O2S/c1-10-3-4-11-9(12)8-5-7(13-2)6-14-8/h5-6,10H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | YWTAZMFOWGJDJM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|