C9H13NO3S — CID 81121281
N-(2-hydroxypropyl)-4-methoxythiophene-2-carboxamide (PubChem CID 81121281) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-4-methoxythiophene-2-carboxamide.
| Compound Name | N-(2-hydroxypropyl)-4-methoxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 81121281 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | N-(2-hydroxypropyl)-4-methoxythiophene-2-carboxamide |
| SMILES | COc1csc(C(=O)NCC(C)O)c1 |
| InChI | InChI=1S/C9H13NO3S/c1-6(11)4-10-9(12)8-3-7(13-2)5-14-8/h3,5-6,11H,4H2,1-2H3,(H,10,12) |
| InChIKey | LKEWBILVZCHBPR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |