C14H15NO4 — CID 126722633
2-[3-[5-(3-hydroxypropyl)-1,2-oxazol-3-yl]phenyl]acetic acid (PubChem CID 126722633) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[3-[5-(3-hydroxypropyl)-1,2-oxazol-3-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[5-(3-hydroxypropyl)-1,2-oxazol-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 126722633 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[3-[5-(3-hydroxypropyl)-1,2-oxazol-3-yl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(-c2cc(CCCO)on2)c1 |
| InChI | InChI=1S/C14H15NO4/c16-6-2-5-12-9-13(15-19-12)11-4-1-3-10(7-11)8-14(17)18/h1,3-4,7,9,16H,2,5-6,8H2,(H,17,18) |
| InChIKey | MLBUQWULIGZXAC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |