C10H7ClFNO — CID 80646398
5-chloro-3-(3-fluoro-4-methylphenyl)-1,2-oxazole (PubChem CID 80646398) has the molecular formula C10H7ClFNO and a molecular weight of 211.62 g/mol. Its IUPAC name is 5-chloro-3-(3-fluoro-4-methylphenyl)-1,2-oxazole.
| Compound Name | 5-chloro-3-(3-fluoro-4-methylphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 80646398 |
| Molecular Formula | C10H7ClFNO |
| Molecular Weight | 211.62 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 5-chloro-3-(3-fluoro-4-methylphenyl)-1,2-oxazole |
| SMILES | Cc1ccc(-c2cc(Cl)on2)cc1F |
| InChI | InChI=1S/C10H7ClFNO/c1-6-2-3-7(4-8(6)12)9-5-10(11)14-13-9/h2-5H,1H3 |
| InChIKey | IHZSQRGEHXOJBL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |