C6H2Cl2N2O2 — CID 102102777
5-chloro-3-(5-chloro-1,2-oxazol-3-yl)-1,2-oxazole (PubChem CID 102102777) has the molecular formula C6H2Cl2N2O2 and a molecular weight of 205.00 g/mol. Its IUPAC name is 5-chloro-3-(5-chloro-1,2-oxazol-3-yl)-1,2-oxazole.
| Compound Name | 5-chloro-3-(5-chloro-1,2-oxazol-3-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 102102777 |
| Molecular Formula | C6H2Cl2N2O2 |
| Molecular Weight | 205.00 g/mol |
| Exact Mass | 203.95 |
| IUPAC Name | 5-chloro-3-(5-chloro-1,2-oxazol-3-yl)-1,2-oxazole |
| SMILES | Clc1cc(-c2cc(Cl)on2)no1 |
| InChI | InChI=1S/C6H2Cl2N2O2/c7-5-1-3(9-11-5)4-2-6(8)12-10-4/h1-2H |
| InChIKey | UILPUEOVHIUFAD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.00 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |