C10H5ClN2O — CID 18612646
3-(5-chloro-1,2-oxazol-3-yl)benzonitrile (PubChem CID 18612646) has the molecular formula C10H5ClN2O and a molecular weight of 204.62 g/mol. Its IUPAC name is 3-(5-chloro-1,2-oxazol-3-yl)benzonitrile.
| Compound Name | 3-(5-chloro-1,2-oxazol-3-yl)benzonitrile |
|---|---|
| PubChem CID | 18612646 |
| Molecular Formula | C10H5ClN2O |
| Molecular Weight | 204.62 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 3-(5-chloro-1,2-oxazol-3-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(Cl)on2)c1 |
| InChI | InChI=1S/C10H5ClN2O/c11-10-5-9(13-14-10)8-3-1-2-7(4-8)6-12/h1-5H |
| InChIKey | AMWKBDDUEHDKCA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.62 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |