C8H10ClNO — CID 80645479
5-chloro-3-cyclopentyl-1,2-oxazole (PubChem CID 80645479) has the molecular formula C8H10ClNO and a molecular weight of 171.63 g/mol. Its IUPAC name is 5-chloro-3-cyclopentyl-1,2-oxazole.
| Compound Name | 5-chloro-3-cyclopentyl-1,2-oxazole |
|---|---|
| PubChem CID | 80645479 |
| Molecular Formula | C8H10ClNO |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 5-chloro-3-cyclopentyl-1,2-oxazole |
| SMILES | Clc1cc(C2CCCC2)no1 |
| InChI | InChI=1S/C8H10ClNO/c9-8-5-7(10-11-8)6-3-1-2-4-6/h5-6H,1-4H2 |
| InChIKey | AXLNHJPOGWAEDQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |