C21H19ClN2O4 — CID 55479074
(3-phenyl-1,2-oxazol-5-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate (PubChem CID 55479074) has the molecular formula C21H19ClN2O4 and a molecular weight of 398.85 g/mol. Its IUPAC name is (3-phenyl-1,2-oxazol-5-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate.
| Compound Name | (3-phenyl-1,2-oxazol-5-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 55479074 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (3-phenyl-1,2-oxazol-5-yl)methyl 3-acetamido-3-(4-chlorophenyl)propanoate |
| SMILES | CC(=O)NC(CC(=O)OCc1cc(-c2ccccc2)no1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClN2O4/c1-14(25)23-19(16-7-9-17(22)10-8-16)12-21(26)27-13-18-11-20(24-28-18)15-5-3-2-4-6-15/h2-11,19H,12-13H2,1H3,(H,23,25) |
| InChIKey | UXJPHWDMSNAMAM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |