C18H19ClN2O3 — CID 8608661
(2-methylphenyl)methyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate (PubChem CID 8608661) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is (2-methylphenyl)methyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate.
| Compound Name | (2-methylphenyl)methyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 8608661 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (2-methylphenyl)methyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
| SMILES | Cc1ccccc1COC(=O)C[C@H](NC(N)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-12-4-2-3-5-14(12)11-24-17(22)10-16(21-18(20)23)13-6-8-15(19)9-7-13/h2-9,16H,10-11H2,1H3,(H3,20,21,23)/t16-/m0/s1 |
| InChIKey | CSHIQLNEKCQSFM-INIZCTEOSA-N |
| XLogP | 3.49 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |