C18H16ClN3O3 — CID 8807602
(2-cyanophenyl)methyl (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate (PubChem CID 8807602) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is (2-cyanophenyl)methyl (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate.
| Compound Name | (2-cyanophenyl)methyl (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 8807602 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | (2-cyanophenyl)methyl (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
| SMILES | N#Cc1ccccc1COC(=O)C[C@@H](NC(N)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN3O3/c19-15-7-5-12(6-8-15)16(22-18(21)24)9-17(23)25-11-14-4-2-1-3-13(14)10-20/h1-8,16H,9,11H2,(H3,21,22,24)/t16-/m1/s1 |
| InChIKey | NKFYTRDILUOJAI-MRXNPFEDSA-N |
| XLogP | 3.05 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |