C18H19ClN2O3 — CID 8606825
[(1S)-1-phenylethyl] (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate (PubChem CID 8606825) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate.
| Compound Name | [(1S)-1-phenylethyl] (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 8606825 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [(1S)-1-phenylethyl] (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
| SMILES | C[C@H](OC(=O)C[C@@H](NC(N)=O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-12(13-5-3-2-4-6-13)24-17(22)11-16(21-18(20)23)14-7-9-15(19)10-8-14/h2-10,12,16H,11H2,1H3,(H3,20,21,23)/t12-,16+/m0/s1 |
| InChIKey | YHGKJUMFTSWJSS-BLLLJJGKSA-N |
| XLogP | 3.74 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |