C16H22ClN3O5 — CID 8727439
[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate (PubChem CID 8727439) has the molecular formula C16H22ClN3O5 and a molecular weight of 371.82 g/mol. Its IUPAC name is [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate.
| Compound Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 8727439 |
| Molecular Formula | C16H22ClN3O5 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
| SMILES | COCCNC(=O)[C@@H](C)OC(=O)C[C@H](NC(N)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClN3O5/c1-10(15(22)19-7-8-24-2)25-14(21)9-13(20-16(18)23)11-3-5-12(17)6-4-11/h3-6,10,13H,7-9H2,1-2H3,(H,19,22)(H3,18,20,23)/t10-,13+/m1/s1 |
| InChIKey | PQPMWYGUIXYSBG-MFKMUULPSA-N |
| XLogP | 1.13 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|