C16H18ClN3O2 — CID 112503079
1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-3-cyclohexylurea (PubChem CID 112503079) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-3-cyclohexylurea.
| Compound Name | 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 112503079 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-3-cyclohexylurea |
| SMILES | O=C(Nc1cc(-c2ccc(Cl)cc2)no1)NC1CCCCC1 |
| InChI | InChI=1S/C16H18ClN3O2/c17-12-8-6-11(7-9-12)14-10-15(22-20-14)19-16(21)18-13-4-2-1-3-5-13/h6-10,13H,1-5H2,(H2,18,19,21) |
| InChIKey | HCGOQJCXSABVJU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |